intermediate 25 minutes

Two-Sample Tests

Learn to compare two groups with hypothesis tests. Master independent t-tests, paired t-tests, and two-proportion tests.

On This Page

Comparing Two Groups

Two-sample tests help answer questions like:

  • Is treatment A better than treatment B?
  • Do men and women differ in some measurement?
  • Did scores improve after an intervention?
Study DesignTest
Two independent groupsIndependent t-test
Same subjects, two measurementsPaired t-test
Two proportionsTwo-proportion z-test

Independent Two-Sample t-Test

Compares means of two separate groups of subjects.

Independent t-Test

t=(xˉ1xˉ2)(μ1μ2)0s12n1+s22n2t = \frac{(\bar{x}_1 - \bar{x}_2) - (\mu_1 - \mu_2)_0}{\sqrt{\frac{s_1^2}{n_1} + \frac{s_2^2}{n_2}}}

Usually testing H₀: μ₁ - μ₂ = 0, so:

t=xˉ1xˉ2s12n1+s22n2t = \frac{\bar{x}_1 - \bar{x}_2}{\sqrt{\frac{s_1^2}{n_1} + \frac{s_2^2}{n_2}}}

Degrees of Freedom

Welch’s approximation (unequal variances assumed):

df=(s12n1+s22n2)2(s12/n1)2n11+(s22/n2)2n21df = \frac{\left(\frac{s_1^2}{n_1} + \frac{s_2^2}{n_2}\right)^2}{\frac{(s_1^2/n_1)^2}{n_1-1} + \frac{(s_2^2/n_2)^2}{n_2-1}}

Conservative approach: df = min(n₁ - 1, n₂ - 1)

Independent t-Test

Question: Do two teaching methods produce different test scores?

Group 1 (Method A): n₁ = 25, x̄₁ = 78, s₁ = 8 Group 2 (Method B): n₂ = 30, x̄₂ = 72, s₂ = 10 α = 0.05, two-tailed

Hypotheses:

  • H₀: μ₁ = μ₂ (no difference)
  • H₁: μ₁ ≠ μ₂ (different)

Standard error: SE=8225+10230=2.56+3.33=5.89=2.43SE = \sqrt{\frac{8^2}{25} + \frac{10^2}{30}} = \sqrt{2.56 + 3.33} = \sqrt{5.89} = 2.43

Test statistic: t=78722.43=62.43=2.47t = \frac{78 - 72}{2.43} = \frac{6}{2.43} = 2.47

df (conservative) = min(24, 29) = 24 Critical t = ±2.064

Decision: Since 2.47 > 2.064, reject H₀

Conclusion: Evidence suggests the methods produce different results.


Pooled vs Unpooled Variance

MethodWhen to Use
Pooled (equal variances)When σ₁ = σ₂ can be assumed
Unpooled (Welch’s)When σ₁ ≠ σ₂ or unsure
Pooled Variance

sp2=(n11)s12+(n21)s22n1+n22s_p^2 = \frac{(n_1-1)s_1^2 + (n_2-1)s_2^2}{n_1 + n_2 - 2}

SE=sp1n1+1n2SE = s_p\sqrt{\frac{1}{n_1} + \frac{1}{n_2}}

df = n₁ + n₂ - 2


Paired t-Test

Use when the same subjects are measured twice or subjects are matched in pairs.

Paired t-Test

Calculate differences: di=x1ix2id_i = x_{1i} - x_{2i}

t=dˉ0sd/nt = \frac{\bar{d} - 0}{s_d / \sqrt{n}}

df = n - 1 (where n = number of pairs)

Paired t-Test

Question: Does a training program improve typing speed?

10 people measured before and after training:

PersonBeforeAfterDifference (d)
145527
238413
355605
442497
550533
635427
748513
841476
952586
1044484

Statistics: n = 10, d̄ = 5.1, s_d = 1.73

Hypotheses:

  • H₀: μ_d = 0 (no improvement)
  • H₁: μ_d > 0 (improvement)

Test statistic: t=5.101.73/10=5.10.547=9.32t = \frac{5.1 - 0}{1.73 / \sqrt{10}} = \frac{5.1}{0.547} = 9.32

df = 9, critical t (α = 0.05, one-tailed) = 1.833

Decision: Since 9.32 > 1.833, reject H₀

Conclusion: Strong evidence that training improves typing speed.

Why Paired Tests Are More Powerful


Two-Proportion z-Test

Compares proportions between two independent groups.

Two-Proportion z-Test

z=p^1p^2p^(1p^)(1n1+1n2)z = \frac{\hat{p}_1 - \hat{p}_2}{\sqrt{\hat{p}(1-\hat{p})\left(\frac{1}{n_1} + \frac{1}{n_2}\right)}}

Where p^=x1+x2n1+n2\hat{p} = \frac{x_1 + x_2}{n_1 + n_2} (pooled proportion)

Two-Proportion Test

Question: Is there a difference in cure rates between two drugs?

Drug A: 80 cured out of 100 (p̂₁ = 0.80) Drug B: 65 cured out of 100 (p̂₂ = 0.65) α = 0.05, two-tailed

Hypotheses:

  • H₀: p₁ = p₂
  • H₁: p₁ ≠ p₂

Pooled proportion: p^=80+65100+100=145200=0.725\hat{p} = \frac{80 + 65}{100 + 100} = \frac{145}{200} = 0.725

Standard error: SE=0.725(0.275)(1100+1100)=0.199×0.02=0.0631SE = \sqrt{0.725(0.275)\left(\frac{1}{100} + \frac{1}{100}\right)} = \sqrt{0.199 \times 0.02} = 0.0631

Test statistic: z=0.800.650.0631=0.150.0631=2.38z = \frac{0.80 - 0.65}{0.0631} = \frac{0.15}{0.0631} = 2.38

Critical values: ±1.96

Decision: Since 2.38 > 1.96, reject H₀

Conclusion: Evidence suggests cure rates differ between drugs.


Independent vs Paired: How to Decide

FeatureIndependentPaired
SubjectsDifferent people in each groupSame people (or matched pairs)
Sample sizesCan be differentMust be equal (n pairs)
DesignRandom assignment to groupsBefore/after, matching
AnalysisCompare two group meansAnalyze differences
Identifying the Design

Independent samples:

  • Compare men’s and women’s salaries
  • Treatment group vs control group (different people)

Paired samples:

  • Weight before and after diet (same people)
  • Left hand vs right hand reaction time (same people)
  • Ratings of two products by same consumers

Assumptions and Conditions

For Independent t-Test

  1. Random samples
  2. Independent groups
  3. Normal populations OR large n (each group)
  4. Equal variances (if using pooled test)

For Paired t-Test

  1. Random sample of pairs
  2. Paired observations
  3. Differences are approximately normal OR large n

For Two-Proportion Test

  1. Independent random samples
  2. n₁p̂₁ ≥ 10, n₁(1-p̂₁) ≥ 10
  3. n₂p̂₂ ≥ 10, n₂(1-p̂₂) ≥ 10

Summary

In this lesson, you learned:

  • Independent t-test: Compares means of two separate groups
  • Paired t-test: Compares means when subjects are measured twice (analyze differences)
  • Two-proportion z-test: Compares proportions between two groups
  • Paired tests control for individual differences and are often more powerful
  • Use Welch’s t-test (unpooled) when variances may differ
  • Always check assumptions before conducting tests

Practice Problems

1. Group 1: n = 15, x̄ = 85, s = 7 Group 2: n = 18, x̄ = 80, s = 9 Test if means differ at α = 0.05.

2. 12 patients’ blood pressure before and after medication: d̄ = -8.5 (decrease), s_d = 6.2 Test if medication reduces blood pressure (one-tailed, α = 0.05).

3. Survey: 45 of 150 men and 62 of 180 women support a policy. Test if proportions differ at α = 0.05.

4. A researcher wants to test if a new fertilizer increases crop yield. She has 20 fields, and applies the fertilizer to half of each field. Should she use independent or paired t-test? Why?

Click to see answers

1. Independent t-test

SE=4915+8118=3.27+4.5=7.77=2.79SE = \sqrt{\frac{49}{15} + \frac{81}{18}} = \sqrt{3.27 + 4.5} = \sqrt{7.77} = 2.79

t=85802.79=1.79t = \frac{85 - 80}{2.79} = 1.79

df (conservative) = min(14, 17) = 14 Critical t = ±2.145

Since |1.79| < 2.145, fail to reject H₀ No significant difference between groups.

2. Paired t-test

H₀: μ_d = 0, H₁: μ_d < 0

t=8.56.2/12=8.51.79=4.75t = \frac{-8.5}{6.2/\sqrt{12}} = \frac{-8.5}{1.79} = -4.75

df = 11, critical t (one-tailed, α = 0.05) = -1.796

Since -4.75 < -1.796, reject H₀ Strong evidence medication reduces blood pressure.

3. Two-proportion z-test

p̂₁ = 45/150 = 0.30, p̂₂ = 62/180 = 0.344 p̂ = (45 + 62)/(150 + 180) = 107/330 = 0.324

SE=0.324(0.676)(1150+1180)=0.219×0.0122=0.0517SE = \sqrt{0.324(0.676)(\frac{1}{150} + \frac{1}{180})} = \sqrt{0.219 \times 0.0122} = 0.0517

z=0.300.3440.0517=0.85z = \frac{0.30 - 0.344}{0.0517} = -0.85

Critical z = ±1.96

Since |-0.85| < 1.96, fail to reject H₀ No significant difference in proportions.

4. Paired t-test

Each field serves as its own control. Half gets fertilizer, half doesn’t. The two measurements (treated vs untreated) come from the same field.

Pairing controls for field-to-field variation (soil quality, drainage, etc.), making it easier to detect the fertilizer effect.

Next Steps

Continue with more advanced testing:

Was this lesson helpful?

Help us improve by sharing your feedback or spreading the word.